C14H22O5S — CID 59637921
[3-[(3-methyl-1,4-oxathiocan-3-yl)oxy]-3-oxopropyl] 2-methylprop-2-enoate (PubChem CID 59637921) has the molecular formula C14H22O5S and a molecular weight of 302.39 g/mol. Its IUPAC name is [3-[(3-methyl-1,4-oxathiocan-3-yl)oxy]-3-oxopropyl] 2-methylprop-2-enoate.
| Compound Name | [3-[(3-methyl-1,4-oxathiocan-3-yl)oxy]-3-oxopropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59637921 |
| Molecular Formula | C14H22O5S |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | [3-[(3-methyl-1,4-oxathiocan-3-yl)oxy]-3-oxopropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(=O)OC1(C)COCCCCS1 |
| InChI | InChI=1S/C14H22O5S/c1-11(2)13(16)18-8-6-12(15)19-14(3)10-17-7-4-5-9-20-14/h1,4-10H2,2-3H3 |
| InChIKey | XFHNLVRTLIOQIW-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|