C20H37N3O — CID 59640538
2-N-[1-[4-[3-(diethylamino)propoxy]phenyl]ethyl]-1-N,1-N-dimethylpropane-1,2-diamine (PubChem CID 59640538) has the molecular formula C20H37N3O and a molecular weight of 335.54 g/mol. Its IUPAC name is 2-N-[1-[4-[3-(diethylamino)propoxy]phenyl]ethyl]-1-N,1-N-dimethylpropane-1,2-diamine.
| Compound Name | 2-N-[1-[4-[3-(diethylamino)propoxy]phenyl]ethyl]-1-N,1-N-dimethylpropane-1,2-diamine |
|---|---|
| PubChem CID | 59640538 |
| Molecular Formula | C20H37N3O |
| Molecular Weight | 335.54 g/mol |
| Exact Mass | 335.29 |
| IUPAC Name | 2-N-[1-[4-[3-(diethylamino)propoxy]phenyl]ethyl]-1-N,1-N-dimethylpropane-1,2-diamine |
| SMILES | CCN(CC)CCCOc1ccc(C(C)NC(C)CN(C)C)cc1 |
| InChI | InChI=1S/C20H37N3O/c1-7-23(8-2)14-9-15-24-20-12-10-19(11-13-20)18(4)21-17(3)16-22(5)6/h10-13,17-18,21H,7-9,14-16H2,1-6H3 |
| InChIKey | WYHNCTYLMCAMGE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.54 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|