C23H24F3NS2 — CID 59648472
cyclohexylmethyl N-phenyl-3-[3-(trifluoromethyl)phenyl]sulfanylprop-2-enimidothioate (PubChem CID 59648472) has the molecular formula C23H24F3NS2 and a molecular weight of 435.58 g/mol. Its IUPAC name is cyclohexylmethyl N-phenyl-3-[3-(trifluoromethyl)phenyl]sulfanylprop-2-enimidothioate.
| Compound Name | cyclohexylmethyl N-phenyl-3-[3-(trifluoromethyl)phenyl]sulfanylprop-2-enimidothioate |
|---|---|
| PubChem CID | 59648472 |
| Molecular Formula | C23H24F3NS2 |
| Molecular Weight | 435.58 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | cyclohexylmethyl N-phenyl-3-[3-(trifluoromethyl)phenyl]sulfanylprop-2-enimidothioate |
| SMILES | FC(F)(F)c1cccc(SC=C/C(=N/c2ccccc2)SCC2CCCCC2)c1 |
| InChI | InChI=1S/C23H24F3NS2/c24-23(25,26)19-10-7-13-21(16-19)28-15-14-22(27-20-11-5-2-6-12-20)29-17-18-8-3-1-4-9-18/h2,5-7,10-16,18H,1,3-4,8-9,17H2/b15-14?,27-22- |
| InChIKey | SIWYELYBLJPJDJ-FVAFQCKFSA-N |
| XLogP | 8.35 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.58 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|