C23H27NOS2 — CID 59648473
cyclohexylmethyl 3-(3-methoxyphenyl)sulfanyl-N-phenylprop-2-enimidothioate (PubChem CID 59648473) has the molecular formula C23H27NOS2 and a molecular weight of 397.61 g/mol. Its IUPAC name is cyclohexylmethyl 3-(3-methoxyphenyl)sulfanyl-N-phenylprop-2-enimidothioate.
| Compound Name | cyclohexylmethyl 3-(3-methoxyphenyl)sulfanyl-N-phenylprop-2-enimidothioate |
|---|---|
| PubChem CID | 59648473 |
| Molecular Formula | C23H27NOS2 |
| Molecular Weight | 397.61 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | cyclohexylmethyl 3-(3-methoxyphenyl)sulfanyl-N-phenylprop-2-enimidothioate |
| SMILES | COc1cccc(SC=C/C(=N/c2ccccc2)SCC2CCCCC2)c1 |
| InChI | InChI=1S/C23H27NOS2/c1-25-21-13-8-14-22(17-21)26-16-15-23(24-20-11-6-3-7-12-20)27-18-19-9-4-2-5-10-19/h3,6-8,11-17,19H,2,4-5,9-10,18H2,1H3/b16-15?,24-23- |
| InChIKey | MRLKQZNDSDFMGW-GBFXAWGBSA-N |
| XLogP | 7.34 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.61 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|