C30H35NO2S3 — CID 87469412
cyclohexylmethyl 3,3-bis[(3-methoxyphenyl)sulfanyl]-N-phenylpropanimidothioate (PubChem CID 87469412) has the molecular formula C30H35NO2S3 and a molecular weight of 537.82 g/mol. Its IUPAC name is cyclohexylmethyl 3,3-bis[(3-methoxyphenyl)sulfanyl]-N-phenylpropanimidothioate.
| Compound Name | cyclohexylmethyl 3,3-bis[(3-methoxyphenyl)sulfanyl]-N-phenylpropanimidothioate |
|---|---|
| PubChem CID | 87469412 |
| Molecular Formula | C30H35NO2S3 |
| Molecular Weight | 537.82 g/mol |
| Exact Mass | 537.18 |
| IUPAC Name | cyclohexylmethyl 3,3-bis[(3-methoxyphenyl)sulfanyl]-N-phenylpropanimidothioate |
| SMILES | COc1cccc(SC(C/C(=N/c2ccccc2)SCC2CCCCC2)Sc2cccc(OC)c2)c1 |
| InChI | InChI=1S/C30H35NO2S3/c1-32-25-15-9-17-27(19-25)35-30(36-28-18-10-16-26(20-28)33-2)21-29(31-24-13-7-4-8-14-24)34-22-23-11-5-3-6-12-23/h4,7-10,13-20,23,30H,3,5-6,11-12,21-22H2,1-2H3/b31-29- |
| InChIKey | DQYQCCNJBSTZSQ-YCNYHXFESA-N |
| XLogP | 9.35 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.82 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|