C31H31N3 — CID 59648774
(2E)-5-[4-[2-[4-(diethylamino)phenyl]ethenyl]-2,3-dimethylcyclopenta-1,3-dien-1-yl]-2-isocyano-3-phenylpenta-2,4-dienenitrile (PubChem CID 59648774) has the molecular formula C31H31N3 and a molecular weight of 445.61 g/mol. Its IUPAC name is (2E)-5-[4-[2-[4-(diethylamino)phenyl]ethenyl]-2,3-dimethylcyclopenta-1,3-dien-1-yl]-2-isocyano-3-phenylpenta-2,4-dienenitrile.
| Compound Name | (2E)-5-[4-[2-[4-(diethylamino)phenyl]ethenyl]-2,3-dimethylcyclopenta-1,3-dien-1-yl]-2-isocyano-3-phenylpenta-2,4-dienenitrile |
|---|---|
| PubChem CID | 59648774 |
| Molecular Formula | C31H31N3 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | (2E)-5-[4-[2-[4-(diethylamino)phenyl]ethenyl]-2,3-dimethylcyclopenta-1,3-dien-1-yl]-2-isocyano-3-phenylpenta-2,4-dienenitrile |
| SMILES | [C-]#[N+]/C(C#N)=C(\C=CC1=C(C)C(C)=C(C=Cc2ccc(N(CC)CC)cc2)C1)c1ccccc1 |
| InChI | InChI=1S/C31H31N3/c1-6-34(7-2)29-18-14-25(15-19-29)13-16-27-21-28(24(4)23(27)3)17-20-30(31(22-32)33-5)26-11-9-8-10-12-26/h8-20H,6-7,21H2,1-4H3/b16-13?,20-17?,31-30+ |
| InChIKey | ABWRYCVFWVLSIV-OHBNWYGPSA-N |
| XLogP | 7.99 |
| TPSA | 31.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|