C22H16FN5O — CID 59654813
2-fluoro-5-phenyl-N-[3-[(E)-2-(2H-tetrazol-5-yl)ethenyl]phenyl]benzamide (PubChem CID 59654813) has the molecular formula C22H16FN5O and a molecular weight of 385.40 g/mol. Its IUPAC name is 2-fluoro-5-phenyl-N-[3-[(E)-2-(2H-tetrazol-5-yl)ethenyl]phenyl]benzamide.
| Compound Name | 2-fluoro-5-phenyl-N-[3-[(E)-2-(2H-tetrazol-5-yl)ethenyl]phenyl]benzamide |
|---|---|
| PubChem CID | 59654813 |
| Molecular Formula | C22H16FN5O |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 2-fluoro-5-phenyl-N-[3-[(E)-2-(2H-tetrazol-5-yl)ethenyl]phenyl]benzamide |
| SMILES | O=C(Nc1cccc(/C=C/c2nn[nH]n2)c1)c1cc(-c2ccccc2)ccc1F |
| InChI | InChI=1S/C22H16FN5O/c23-20-11-10-17(16-6-2-1-3-7-16)14-19(20)22(29)24-18-8-4-5-15(13-18)9-12-21-25-27-28-26-21/h1-14H,(H,24,29)(H,25,26,27,28)/b12-9+ |
| InChIKey | IAJOMUSMQCLVGG-FMIVXFBMSA-N |
| XLogP | 4.43 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |