C21H25NOS2 — CID 59676113
9-methoxy-11,11b-dimethylspiro[1,2,5,6-tetrahydrobenzo[a]carbazole-3,2'-1,3-dithiolane] (PubChem CID 59676113) has the molecular formula C21H25NOS2 and a molecular weight of 371.57 g/mol. Its IUPAC name is 9-methoxy-11,11b-dimethylspiro[1,2,5,6-tetrahydrobenzo[a]carbazole-3,2'-1,3-dithiolane].
| Compound Name | 9-methoxy-11,11b-dimethylspiro[1,2,5,6-tetrahydrobenzo[a]carbazole-3,2'-1,3-dithiolane] |
|---|---|
| PubChem CID | 59676113 |
| Molecular Formula | C21H25NOS2 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 9-methoxy-11,11b-dimethylspiro[1,2,5,6-tetrahydrobenzo[a]carbazole-3,2'-1,3-dithiolane] |
| SMILES | COc1ccc2c3c(n(C)c2c1)C1(C)CCC2(C=C1CC3)SCCS2 |
| InChI | InChI=1S/C21H25NOS2/c1-20-8-9-21(24-10-11-25-21)13-14(20)4-6-17-16-7-5-15(23-3)12-18(16)22(2)19(17)20/h5,7,12-13H,4,6,8-11H2,1-3H3 |
| InChIKey | LSFPFTWHTVXTCK-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|