C19H23NOS2 — CID 89042110
9-methoxy-11,11b-dimethyl-1,2,5,6-tetrahydrobenzo[a]carbazole-3,3-dithiol (PubChem CID 89042110) has the molecular formula C19H23NOS2 and a molecular weight of 345.53 g/mol. Its IUPAC name is 9-methoxy-11,11b-dimethyl-1,2,5,6-tetrahydrobenzo[a]carbazole-3,3-dithiol.
| Compound Name | 9-methoxy-11,11b-dimethyl-1,2,5,6-tetrahydrobenzo[a]carbazole-3,3-dithiol |
|---|---|
| PubChem CID | 89042110 |
| Molecular Formula | C19H23NOS2 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 9-methoxy-11,11b-dimethyl-1,2,5,6-tetrahydrobenzo[a]carbazole-3,3-dithiol |
| SMILES | COc1ccc2c3c(n(C)c2c1)C1(C)CCC(S)(S)C=C1CC3 |
| InChI | InChI=1S/C19H23NOS2/c1-18-8-9-19(22,23)11-12(18)4-6-15-14-7-5-13(21-3)10-16(14)20(2)17(15)18/h5,7,10-11,22-23H,4,6,8-9H2,1-3H3 |
| InChIKey | HUUPPDDZOXCCAS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 14.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|