C6H11ORe- — CID 59678716
hexan-2-one;rhenium (PubChem CID 59678716) has the molecular formula C6H11ORe- and a molecular weight of 285.36 g/mol. Its IUPAC name is hexan-2-one;rhenium.
| Compound Name | hexan-2-one;rhenium |
|---|---|
| PubChem CID | 59678716 |
| Molecular Formula | C6H11ORe- |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | hexan-2-one;rhenium |
| SMILES | C[CH-]CCC(C)=O.[Re] |
| InChI | InChI=1S/C6H11O.Re/c1-3-4-5-6(2)7;/h3H,4-5H2,1-2H3;/q-1; |
| InChIKey | ZHKFZVWTOZLLJW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|