C12H23FO — CID 11623
12-fluorododecan-2-one (PubChem CID 11623) has the molecular formula C12H23FO and a molecular weight of 202.31 g/mol. Its IUPAC name is 12-fluorododecan-2-one.
| Compound Name | 12-fluorododecan-2-one |
|---|---|
| PubChem CID | 11623 |
| Molecular Formula | C12H23FO |
| Molecular Weight | 202.31 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 12-fluorododecan-2-one |
| SMILES | CC(=O)CCCCCCCCCCF |
| InChI | InChI=1S/C12H23FO/c1-12(14)10-8-6-4-2-3-5-7-9-11-13/h2-11H2,1H3 |
| InChIKey | FGHBRNRFQMGLKK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.31 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|