C8H17OSi — CID 58391631
CID 58391631 (PubChem CID 58391631) has the molecular formula C8H17OSi and a molecular weight of 157.31 g/mol.
| Compound Name | CID 58391631 |
|---|---|
| PubChem CID | 58391631 |
| Molecular Formula | C8H17OSi |
| Molecular Weight | 157.31 g/mol |
| Exact Mass | 157.10 |
| IUPAC Name | — |
| SMILES | CC(=O)CCCC[Si](C)C |
| InChI | InChI=1S/C8H17OSi/c1-8(9)6-4-5-7-10(2)3/h4-7H2,1-3H3 |
| InChIKey | DAMPWBYANBOIFA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|