C15H18N2O4P2U2 — CID 59679788
phosphane;[4-[[4-(phosphanyloxycarbonylamino)phenyl]methyl]phenyl]carbamic acid;uranium (PubChem CID 59679788) has the molecular formula C15H18N2O4P2U2 and a molecular weight of 828.32 g/mol. Its IUPAC name is phosphane;[4-[[4-(phosphanyloxycarbonylamino)phenyl]methyl]phenyl]carbamic acid;uranium.
| Compound Name | phosphane;[4-[[4-(phosphanyloxycarbonylamino)phenyl]methyl]phenyl]carbamic acid;uranium |
|---|---|
| PubChem CID | 59679788 |
| Molecular Formula | C15H18N2O4P2U2 |
| Molecular Weight | 828.32 g/mol |
| Exact Mass | 828.18 |
| IUPAC Name | phosphane;[4-[[4-(phosphanyloxycarbonylamino)phenyl]methyl]phenyl]carbamic acid;uranium |
| SMILES | O=C(O)Nc1ccc(Cc2ccc(NC(=O)OP)cc2)cc1.P.[U].[U] |
| InChI | InChI=1S/C15H15N2O4P.H3P.2U/c18-14(19)16-12-5-1-10(2-6-12)9-11-3-7-13(8-4-11)17-15(20)21-22;;;/h1-8,16H,9,22H2,(H,17,20)(H,18,19);1H3;; |
| InChIKey | VXKMEHOWWBBXRB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|