About ethyl 6-ethenyl-1,4-dihydrocyclopenta[b]pyrrole-2-carboxylate
ethyl 6-ethenyl-1,4-dihydrocyclopenta[b]pyrrole-2-carboxylate (PubChem CID 59683332) has the molecular formula C12H13NO2
and a molecular weight of 203.24 g/mol. Its IUPAC name is ethyl 6-ethenyl-1,4-dihydrocyclopenta[b]pyrrole-2-carboxylate.
Analyze ethyl 6-ethenyl-1,4-dihydrocyclopenta[b]pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-ethenyl-1,4-dihydrocyclopenta[b]pyrrole-2-carboxylate?
The IUPAC name of ethyl 6-ethenyl-1,4-dihydrocyclopenta[b]pyrrole-2-carboxylate (CID 59683332) is ethyl 6-ethenyl-1,4-dihydrocyclopenta[b]pyrrole-2-carboxylate.
What is the SMILES notation for ethyl 6-ethenyl-1,4-dihydrocyclopenta[b]pyrrole-2-carboxylate?
The canonical SMILES for ethyl 6-ethenyl-1,4-dihydrocyclopenta[b]pyrrole-2-carboxylate is C=CC1=CCc2cc(C(=O)OCC)[nH]c21.
What is the InChIKey of ethyl 6-ethenyl-1,4-dihydrocyclopenta[b]pyrrole-2-carboxylate?
The InChIKey is TUMIWFWWIOEPGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2/c1-3-8-5-6-9-7-10(13-11(8)9)12(14)15-4-2/h3,5,7,13H,1,4,6H2,2H3.
What are the key properties of ethyl 6-ethenyl-1,4-dihydrocyclopenta[b]pyrrole-2-carboxylate?
ethyl 6-ethenyl-1,4-dihydrocyclopenta[b]pyrrole-2-carboxylate has a molecular weight of 203.24 g/mol, XLogP of 2.32, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-ethenyl-1,4-dihydrocyclopenta[b]pyrrole-2-carboxylate is sourced from PubChem (CID 59683332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).