C27H26N4O — CID 59686161
3H-benzimidazol-5-yl-(2,3-diphenyl-2,7-diazaspiro[3.5]nonan-7-yl)methanone (PubChem CID 59686161) has the molecular formula C27H26N4O and a molecular weight of 422.53 g/mol. Its IUPAC name is 3H-benzimidazol-5-yl-(2,3-diphenyl-2,7-diazaspiro[3.5]nonan-7-yl)methanone.
| Compound Name | 3H-benzimidazol-5-yl-(2,3-diphenyl-2,7-diazaspiro[3.5]nonan-7-yl)methanone |
|---|---|
| PubChem CID | 59686161 |
| Molecular Formula | C27H26N4O |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 3H-benzimidazol-5-yl-(2,3-diphenyl-2,7-diazaspiro[3.5]nonan-7-yl)methanone |
| SMILES | O=C(c1ccc2nc[nH]c2c1)N1CCC2(CC1)CN(c1ccccc1)C2c1ccccc1 |
| InChI | InChI=1S/C27H26N4O/c32-26(21-11-12-23-24(17-21)29-19-28-23)30-15-13-27(14-16-30)18-31(22-9-5-2-6-10-22)25(27)20-7-3-1-4-8-20/h1-12,17,19,25H,13-16,18H2,(H,28,29) |
| InChIKey | YURCMFRNARNAOF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |