C23H17F3O2 — CID 59695866
1-[4-[4-[difluoro-(4-fluoro-2-methylphenyl)methoxy]phenyl]phenyl]prop-2-en-1-one (PubChem CID 59695866) has the molecular formula C23H17F3O2 and a molecular weight of 382.38 g/mol. Its IUPAC name is 1-[4-[4-[difluoro-(4-fluoro-2-methylphenyl)methoxy]phenyl]phenyl]prop-2-en-1-one.
| Compound Name | 1-[4-[4-[difluoro-(4-fluoro-2-methylphenyl)methoxy]phenyl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 59695866 |
| Molecular Formula | C23H17F3O2 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 1-[4-[4-[difluoro-(4-fluoro-2-methylphenyl)methoxy]phenyl]phenyl]prop-2-en-1-one |
| SMILES | C=CC(=O)c1ccc(-c2ccc(OC(F)(F)c3ccc(F)cc3C)cc2)cc1 |
| InChI | InChI=1S/C23H17F3O2/c1-3-22(27)18-6-4-16(5-7-18)17-8-11-20(12-9-17)28-23(25,26)21-13-10-19(24)14-15(21)2/h3-14H,1H2,2H3 |
| InChIKey | AVTVPDLYALYMNX-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|