C24H21N3O3 — CID 59698095
N-[(2S,3R)-3-hydroxy-1-oxo-1-(pyridin-2-ylamino)butan-2-yl]-4-(2-phenylethynyl)benzamide (PubChem CID 59698095) has the molecular formula C24H21N3O3 and a molecular weight of 399.45 g/mol. Its IUPAC name is N-[(2S,3R)-3-hydroxy-1-oxo-1-(pyridin-2-ylamino)butan-2-yl]-4-(2-phenylethynyl)benzamide.
| Compound Name | N-[(2S,3R)-3-hydroxy-1-oxo-1-(pyridin-2-ylamino)butan-2-yl]-4-(2-phenylethynyl)benzamide |
|---|---|
| PubChem CID | 59698095 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | N-[(2S,3R)-3-hydroxy-1-oxo-1-(pyridin-2-ylamino)butan-2-yl]-4-(2-phenylethynyl)benzamide |
| SMILES | C[C@@H](O)[C@H](NC(=O)c1ccc(C#Cc2ccccc2)cc1)C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C24H21N3O3/c1-17(28)22(24(30)26-21-9-5-6-16-25-21)27-23(29)20-14-12-19(13-15-20)11-10-18-7-3-2-4-8-18/h2-9,12-17,22,28H,1H3,(H,27,29)(H,25,26,30)/t17-,22+/m1/s1 |
| InChIKey | YTZYZWBBFBECOE-VGSWGCGISA-N |
| XLogP | 2.60 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|