C19H18F3N3O5S — CID 59710583
N-[(1R)-1-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]ethyl]-4-[4-(trifluoromethyl)phenoxy]benzenesulfonamide (PubChem CID 59710583) has the molecular formula C19H18F3N3O5S and a molecular weight of 457.43 g/mol. Its IUPAC name is N-[(1R)-1-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]ethyl]-4-[4-(trifluoromethyl)phenoxy]benzenesulfonamide.
| Compound Name | N-[(1R)-1-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]ethyl]-4-[4-(trifluoromethyl)phenoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 59710583 |
| Molecular Formula | C19H18F3N3O5S |
| Molecular Weight | 457.43 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | N-[(1R)-1-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]ethyl]-4-[4-(trifluoromethyl)phenoxy]benzenesulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)c1ccc(Oc2ccc(C(F)(F)F)cc2)cc1)[C@@]1(C)NC(=O)NC1=O |
| InChI | InChI=1S/C19H18F3N3O5S/c1-11(18(2)16(26)23-17(27)24-18)25-31(28,29)15-9-7-14(8-10-15)30-13-5-3-12(4-6-13)19(20,21)22/h3-11,25H,1-2H3,(H2,23,24,26,27)/t11-,18-/m1/s1 |
| InChIKey | YQOOSRFZFVRUAA-ADLMAVQZSA-N |
| XLogP | 2.76 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|