C17H18N4O5S — CID 59710545
N-[(1R)-1-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]ethyl]-4-pyridin-2-yloxybenzenesulfonamide (PubChem CID 59710545) has the molecular formula C17H18N4O5S and a molecular weight of 390.42 g/mol. Its IUPAC name is N-[(1R)-1-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]ethyl]-4-pyridin-2-yloxybenzenesulfonamide.
| Compound Name | N-[(1R)-1-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]ethyl]-4-pyridin-2-yloxybenzenesulfonamide |
|---|---|
| PubChem CID | 59710545 |
| Molecular Formula | C17H18N4O5S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | N-[(1R)-1-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]ethyl]-4-pyridin-2-yloxybenzenesulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)c1ccc(Oc2ccccn2)cc1)[C@]1(C)NC(=O)NC1=O |
| InChI | InChI=1S/C17H18N4O5S/c1-11(17(2)15(22)19-16(23)20-17)21-27(24,25)13-8-6-12(7-9-13)26-14-5-3-4-10-18-14/h3-11,21H,1-2H3,(H2,19,20,22,23)/t11-,17+/m1/s1 |
| InChIKey | XZXHZOJPYUHHHY-DIFFPNOSSA-N |
| XLogP | 1.14 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|