C10H14N2O — CID 59723653
(5Z)-5-ethylidene-1,3-dimethyl-2,6-dimethylidene-1,3-diazinan-4-one (PubChem CID 59723653) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is (5Z)-5-ethylidene-1,3-dimethyl-2,6-dimethylidene-1,3-diazinan-4-one.
| Compound Name | (5Z)-5-ethylidene-1,3-dimethyl-2,6-dimethylidene-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 59723653 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | (5Z)-5-ethylidene-1,3-dimethyl-2,6-dimethylidene-1,3-diazinan-4-one |
| SMILES | C=C1/C(=C/C)C(=O)N(C)C(=C)N1C |
| InChI | InChI=1S/C10H14N2O/c1-6-9-7(2)11(4)8(3)12(5)10(9)13/h6H,2-3H2,1,4-5H3/b9-6- |
| InChIKey | IIFNHFMAINRXMA-TWGQIWQCSA-N |
| XLogP | 1.32 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|