About methyl 7-methoxy-5-methyl-2H-1,3-benzoxazole-3-carboxylate
methyl 7-methoxy-5-methyl-2H-1,3-benzoxazole-3-carboxylate (PubChem CID 59723692) has the molecular formula C11H13NO4
and a molecular weight of 223.23 g/mol. Its IUPAC name is methyl 7-methoxy-5-methyl-2H-1,3-benzoxazole-3-carboxylate.
Analyze methyl 7-methoxy-5-methyl-2H-1,3-benzoxazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-methoxy-5-methyl-2H-1,3-benzoxazole-3-carboxylate?
The IUPAC name of methyl 7-methoxy-5-methyl-2H-1,3-benzoxazole-3-carboxylate (CID 59723692) is methyl 7-methoxy-5-methyl-2H-1,3-benzoxazole-3-carboxylate.
What is the SMILES notation for methyl 7-methoxy-5-methyl-2H-1,3-benzoxazole-3-carboxylate?
The canonical SMILES for methyl 7-methoxy-5-methyl-2H-1,3-benzoxazole-3-carboxylate is COC(=O)N1COc2c(OC)cc(C)cc21.
What is the InChIKey of methyl 7-methoxy-5-methyl-2H-1,3-benzoxazole-3-carboxylate?
The InChIKey is SDGKPTVVBITVEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO4/c1-7-4-8-10(9(5-7)14-2)16-6-12(8)11(13)15-3/h4-5H,6H2,1-3H3.
What are the key properties of methyl 7-methoxy-5-methyl-2H-1,3-benzoxazole-3-carboxylate?
methyl 7-methoxy-5-methyl-2H-1,3-benzoxazole-3-carboxylate has a molecular weight of 223.23 g/mol, XLogP of 1.93, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-methoxy-5-methyl-2H-1,3-benzoxazole-3-carboxylate is sourced from PubChem (CID 59723692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).