C33H29N3O3 — CID 59726646
ethyl 6-[3-[1-[(2,4-dimethylphenyl)methyl]-5-isocyano-4-methyl-6-oxo-2-pyridinyl]phenyl]-1H-indole-2-carboxylate (PubChem CID 59726646) has the molecular formula C33H29N3O3 and a molecular weight of 515.61 g/mol. Its IUPAC name is ethyl 6-[3-[1-[(2,4-dimethylphenyl)methyl]-5-isocyano-4-methyl-6-oxo-2-pyridinyl]phenyl]-1H-indole-2-carboxylate.
| Compound Name | ethyl 6-[3-[1-[(2,4-dimethylphenyl)methyl]-5-isocyano-4-methyl-6-oxo-2-pyridinyl]phenyl]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 59726646 |
| Molecular Formula | C33H29N3O3 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | ethyl 6-[3-[1-[(2,4-dimethylphenyl)methyl]-5-isocyano-4-methyl-6-oxo-2-pyridinyl]phenyl]-1H-indole-2-carboxylate |
| SMILES | [C-]#[N+]c1c(C)cc(-c2cccc(-c3ccc4cc(C(=O)OCC)[nH]c4c3)c2)n(Cc2ccc(C)cc2C)c1=O |
| InChI | InChI=1S/C33H29N3O3/c1-6-39-33(38)29-18-25-13-12-24(17-28(25)35-29)23-8-7-9-26(16-23)30-15-22(4)31(34-5)32(37)36(30)19-27-11-10-20(2)14-21(27)3/h7-18,35H,6,19H2,1-4H3 |
| InChIKey | RFGDBNKNKVRLFZ-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|