C46H50N8NiO6-2 — CID 59728743
bis(3-(2-ethylhexoxycarbonyl)-8-(pyridin-2-yldiazenyl)quinolin-5-olate);nickel (PubChem CID 59728743) has the molecular formula C46H50N8NiO6-2 and a molecular weight of 869.65 g/mol. Its IUPAC name is bis(3-(2-ethylhexoxycarbonyl)-8-(pyridin-2-yldiazenyl)quinolin-5-olate);nickel.
| Compound Name | bis(3-(2-ethylhexoxycarbonyl)-8-(pyridin-2-yldiazenyl)quinolin-5-olate);nickel |
|---|---|
| PubChem CID | 59728743 |
| Molecular Formula | C46H50N8NiO6-2 |
| Molecular Weight | 869.65 g/mol |
| Exact Mass | 868.32 |
| IUPAC Name | bis(3-(2-ethylhexoxycarbonyl)-8-(pyridin-2-yldiazenyl)quinolin-5-olate);nickel |
| SMILES | CCCCC(CC)COC(=O)c1cnc2c(/N=N/c3ccccn3)ccc([O-])c2c1.CCCCC(CC)COC(=O)c1cnc2c(/N=N\c3ccccn3)ccc([O-])c2c1.[Ni] |
| InChI | InChI=1S/2C23H26N4O3.Ni/c2*1-3-5-8-16(4-2)15-30-23(29)17-13-18-20(28)11-10-19(22(18)25-14-17)26-27-21-9-6-7-12-24-21;/h2*6-7,9-14,16,28H,3-5,8,15H2,1-2H3;/p-2/b27-26+;27-26-; |
| InChIKey | HVGFXLBWUDGCED-YNIQPPRJSA-L |
| XLogP | 10.98 |
| TPSA | 199.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.65 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|