C23H36BIOP — CID 59729540
CID 59729540 (PubChem CID 59729540) has the molecular formula C23H36BIOP and a molecular weight of 497.23 g/mol.
| Compound Name | CID 59729540 |
|---|---|
| PubChem CID | 59729540 |
| Molecular Formula | C23H36BIOP |
| Molecular Weight | 497.23 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | — |
| SMILES | C=C(C)CC(C)CC(C)(C[B]P(I)C(C)(CO)c1ccccc1)CC(=C)C |
| InChI | InChI=1S/C23H36BIOP/c1-18(2)13-20(5)15-22(6,14-19(3)4)16-24-27(25)23(7,17-26)21-11-9-8-10-12-21/h8-12,20,26H,1,3,13-17H2,2,4-7H3 |
| InChIKey | HMMQEOPGQDIMFD-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.23 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|