C13H16N2O3S — CID 59731866
2,2-dioxo-3-piperidin-4-yl-1H-2λ6,1-benzothiazin-4-one (PubChem CID 59731866) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is 2,2-dioxo-3-piperidin-4-yl-1H-2λ6,1-benzothiazin-4-one.
| Compound Name | 2,2-dioxo-3-piperidin-4-yl-1H-2λ6,1-benzothiazin-4-one |
|---|---|
| PubChem CID | 59731866 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 2,2-dioxo-3-piperidin-4-yl-1H-2λ6,1-benzothiazin-4-one |
| SMILES | O=C1c2ccccc2NS(=O)(=O)C1C1CCNCC1 |
| InChI | InChI=1S/C13H16N2O3S/c16-12-10-3-1-2-4-11(10)15-19(17,18)13(12)9-5-7-14-8-6-9/h1-4,9,13-15H,5-8H2 |
| InChIKey | PEBFYLFUUXPMOG-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |