About 5,5-dioxo-6H-benzo[c][1,2]benzothiazepin-11-one
5,5-dioxo-6H-benzo[c][1,2]benzothiazepin-11-one (PubChem CID 10978163) has the molecular formula C13H9NO3S
and a molecular weight of 259.29 g/mol. Its IUPAC name is 5,5-dioxo-6H-benzo[c][1,2]benzothiazepin-11-one.
Molecular Properties
| Compound Name | 5,5-dioxo-6H-benzo[c][1,2]benzothiazepin-11-one |
| PubChem CID | 10978163 |
| Molecular Formula | C13H9NO3S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | 5,5-dioxo-6H-benzo[c][1,2]benzothiazepin-11-one |
| SMILES | O=C1c2ccccc2NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C13H9NO3S/c15-13-9-5-1-3-7-11(9)14-18(16,17)12-8-4-2-6-10(12)13/h1-8,14H |
| InChIKey | QSXVAZSYOKDHJY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dioxo-6H-benzo[c][1,2]benzothiazepin-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dioxo-6H-benzo[c][1,2]benzothiazepin-11-one?
The IUPAC name of 5,5-dioxo-6H-benzo[c][1,2]benzothiazepin-11-one (CID 10978163) is 5,5-dioxo-6H-benzo[c][1,2]benzothiazepin-11-one.
What is the SMILES notation for 5,5-dioxo-6H-benzo[c][1,2]benzothiazepin-11-one?
The canonical SMILES for 5,5-dioxo-6H-benzo[c][1,2]benzothiazepin-11-one is O=C1c2ccccc2NS(=O)(=O)c2ccccc21.
What is the InChIKey of 5,5-dioxo-6H-benzo[c][1,2]benzothiazepin-11-one?
The InChIKey is QSXVAZSYOKDHJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO3S/c15-13-9-5-1-3-7-11(9)14-18(16,17)12-8-4-2-6-10(12)13/h1-8,14H.
What are the key properties of 5,5-dioxo-6H-benzo[c][1,2]benzothiazepin-11-one?
5,5-dioxo-6H-benzo[c][1,2]benzothiazepin-11-one has a molecular weight of 259.29 g/mol, XLogP of 2.03, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dioxo-6H-benzo[c][1,2]benzothiazepin-11-one is sourced from PubChem (CID 10978163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).