C9H7NO3S — CID 18730791
3-methylidene-2,2-dioxo-1H-2lambda6,1-benzothiazin-4-one (PubChem CID 18730791) has the molecular formula C9H7NO3S and a molecular weight of 209.23 g/mol. Its IUPAC name is 3-methylidene-2,2-dioxo-1H-2lambda6,1-benzothiazin-4-one.
| Compound Name | 3-methylidene-2,2-dioxo-1H-2lambda6,1-benzothiazin-4-one |
|---|---|
| PubChem CID | 18730791 |
| Molecular Formula | C9H7NO3S |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.01 |
| IUPAC Name | 3-methylidene-2,2-dioxo-1H-2lambda6,1-benzothiazin-4-one |
| SMILES | C=C1C(=O)c2ccccc2NS1(=O)=O |
| InChI | InChI=1S/C9H7NO3S/c1-6-9(11)7-4-2-3-5-8(7)10-14(6,12)13/h2-5,10H,1H2 |
| InChIKey | RSHTVGIQKIAMSX-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|