C16H11NO2S — CID 13352854
5H-naphtho[2,3-c][2,1]benzothiazine 6,6-dioxide (PubChem CID 13352854) has the molecular formula C16H11NO2S and a molecular weight of 281.34 g/mol. Its IUPAC name is 5H-naphtho[2,3-c][2,1]benzothiazine 6,6-dioxide.
| Compound Name | 5H-naphtho[2,3-c][2,1]benzothiazine 6,6-dioxide |
|---|---|
| PubChem CID | 13352854 |
| Molecular Formula | C16H11NO2S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 5H-naphtho[2,3-c][2,1]benzothiazine 6,6-dioxide |
| SMILES | O=S1(=O)Nc2ccccc2-c2cc3ccccc3cc21 |
| InChI | InChI=1S/C16H11NO2S/c18-20(19)16-10-12-6-2-1-5-11(12)9-14(16)13-7-3-4-8-15(13)17-20/h1-10,17H |
| InChIKey | MLBFKQSJRIPUPP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |