C30H49F3O4Si — CID 59732574
[(1S)-2-methyl-5-(trifluoromethyl)cyclohepta-2,5-dien-1-yl] (3S,6R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-3,4,4,6,8-pentamethyl-5-oxodec-9-enoate (PubChem CID 59732574) has the molecular formula C30H49F3O4Si and a molecular weight of 558.80 g/mol. Its IUPAC name is [(1S)-2-methyl-5-(trifluoromethyl)cyclohepta-2,5-dien-1-yl] (3S,6R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-3,4,4,6,8-pentamethyl-5-oxodec-9-enoate.
| Compound Name | [(1S)-2-methyl-5-(trifluoromethyl)cyclohepta-2,5-dien-1-yl] (3S,6R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-3,4,4,6,8-pentamethyl-5-oxodec-9-enoate |
|---|---|
| PubChem CID | 59732574 |
| Molecular Formula | C30H49F3O4Si |
| Molecular Weight | 558.80 g/mol |
| Exact Mass | 558.34 |
| IUPAC Name | [(1S)-2-methyl-5-(trifluoromethyl)cyclohepta-2,5-dien-1-yl] (3S,6R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-3,4,4,6,8-pentamethyl-5-oxodec-9-enoate |
| SMILES | C=C[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)C(C)(C)[C@@H](C)CC(=O)O[C@H]1CC=C(C(F)(F)F)CC=C1C |
| InChI | InChI=1S/C30H49F3O4Si/c1-13-19(2)26(37-38(11,12)28(6,7)8)22(5)27(35)29(9,10)21(4)18-25(34)36-24-17-16-23(30(31,32)33)15-14-20(24)3/h13-14,16,19,21-22,24,26H,1,15,17-18H2,2-12H3/t19-,21-,22+,24-,26-/m0/s1 |
| InChIKey | SRSXARKBDWGOJE-PVIHEHHISA-N |
| XLogP | 8.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.80 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|