About 1-heptyl-1,3-diazetidin-2-one
1-heptyl-1,3-diazetidin-2-one (PubChem CID 59733785) has the molecular formula C9H18N2O
and a molecular weight of 170.26 g/mol. Its IUPAC name is 1-heptyl-1,3-diazetidin-2-one.
Molecular Properties
| Compound Name | 1-heptyl-1,3-diazetidin-2-one |
| PubChem CID | 59733785 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | 1-heptyl-1,3-diazetidin-2-one |
| SMILES | CCCCCCCN1CNC1=O |
| InChI | InChI=1S/C9H18N2O/c1-2-3-4-5-6-7-11-8-10-9(11)12/h2-8H2,1H3,(H,10,12) |
| InChIKey | SZRHQEWLDLECJZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-heptyl-1,3-diazetidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-heptyl-1,3-diazetidin-2-one?
The IUPAC name of 1-heptyl-1,3-diazetidin-2-one (CID 59733785) is 1-heptyl-1,3-diazetidin-2-one.
What is the SMILES notation for 1-heptyl-1,3-diazetidin-2-one?
The canonical SMILES for 1-heptyl-1,3-diazetidin-2-one is CCCCCCCN1CNC1=O.
What is the InChIKey of 1-heptyl-1,3-diazetidin-2-one?
The InChIKey is SZRHQEWLDLECJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O/c1-2-3-4-5-6-7-11-8-10-9(11)12/h2-8H2,1H3,(H,10,12).
What are the key properties of 1-heptyl-1,3-diazetidin-2-one?
1-heptyl-1,3-diazetidin-2-one has a molecular weight of 170.26 g/mol, XLogP of 1.94, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-heptyl-1,3-diazetidin-2-one is sourced from PubChem (CID 59733785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).