C14H16N4O4S — CID 59736955
tert-butyl N-[4-(3-amino-4-nitrophenyl)-1,3-thiazol-2-yl]carbamate (PubChem CID 59736955) has the molecular formula C14H16N4O4S and a molecular weight of 336.37 g/mol. Its IUPAC name is tert-butyl N-[4-(3-amino-4-nitrophenyl)-1,3-thiazol-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-(3-amino-4-nitrophenyl)-1,3-thiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 59736955 |
| Molecular Formula | C14H16N4O4S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | tert-butyl N-[4-(3-amino-4-nitrophenyl)-1,3-thiazol-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1nc(-c2ccc([N+](=O)[O-])c(N)c2)cs1 |
| InChI | InChI=1S/C14H16N4O4S/c1-14(2,3)22-13(19)17-12-16-10(7-23-12)8-4-5-11(18(20)21)9(15)6-8/h4-7H,15H2,1-3H3,(H,16,17,19) |
| InChIKey | NXNAQEDUWLKNNY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 120.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|