C25H23N3O — CID 59737260
N-(2-amino-5-phenylphenyl)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide (PubChem CID 59737260) has the molecular formula C25H23N3O and a molecular weight of 381.48 g/mol. Its IUPAC name is N-(2-amino-5-phenylphenyl)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide.
| Compound Name | N-(2-amino-5-phenylphenyl)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 59737260 |
| Molecular Formula | C25H23N3O |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | N-(2-amino-5-phenylphenyl)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
| SMILES | Nc1ccc(-c2ccccc2)cc1NC(=O)c1ccc2[nH]c3c(c2c1)CCCC3 |
| InChI | InChI=1S/C25H23N3O/c26-21-12-10-17(16-6-2-1-3-7-16)15-24(21)28-25(29)18-11-13-23-20(14-18)19-8-4-5-9-22(19)27-23/h1-3,6-7,10-15,27H,4-5,8-9,26H2,(H,28,29) |
| InChIKey | FWEKCSNCZVRXFU-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|