C13H17F7O4 — CID 59741586
2,2,3,3-tetrafluoropropyl 3,3,3-trifluoro-2-methyl-2-[(3-methyl-1,4-dioxan-2-yl)methyl]propanoate (PubChem CID 59741586) has the molecular formula C13H17F7O4 and a molecular weight of 370.26 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoropropyl 3,3,3-trifluoro-2-methyl-2-[(3-methyl-1,4-dioxan-2-yl)methyl]propanoate.
| Compound Name | 2,2,3,3-tetrafluoropropyl 3,3,3-trifluoro-2-methyl-2-[(3-methyl-1,4-dioxan-2-yl)methyl]propanoate |
|---|---|
| PubChem CID | 59741586 |
| Molecular Formula | C13H17F7O4 |
| Molecular Weight | 370.26 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 2,2,3,3-tetrafluoropropyl 3,3,3-trifluoro-2-methyl-2-[(3-methyl-1,4-dioxan-2-yl)methyl]propanoate |
| SMILES | CC1OCCOC1CC(C)(C(=O)OCC(F)(F)C(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H17F7O4/c1-7-8(23-4-3-22-7)5-11(2,13(18,19)20)10(21)24-6-12(16,17)9(14)15/h7-9H,3-6H2,1-2H3 |
| InChIKey | YAXONQZYFCFBEK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.26 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|