C22H29N5O6S2 — CID 59743371
N-[4-[[4-[7-(3-methylsulfonylpropoxy)-1,2-benzoxazol-3-yl]pyrimidin-2-yl]amino]cyclohexyl]methanesulfonamide (PubChem CID 59743371) has the molecular formula C22H29N5O6S2 and a molecular weight of 523.64 g/mol. Its IUPAC name is N-[4-[[4-[7-(3-methylsulfonylpropoxy)-1,2-benzoxazol-3-yl]pyrimidin-2-yl]amino]cyclohexyl]methanesulfonamide.
| Compound Name | N-[4-[[4-[7-(3-methylsulfonylpropoxy)-1,2-benzoxazol-3-yl]pyrimidin-2-yl]amino]cyclohexyl]methanesulfonamide |
|---|---|
| PubChem CID | 59743371 |
| Molecular Formula | C22H29N5O6S2 |
| Molecular Weight | 523.64 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | N-[4-[[4-[7-(3-methylsulfonylpropoxy)-1,2-benzoxazol-3-yl]pyrimidin-2-yl]amino]cyclohexyl]methanesulfonamide |
| SMILES | CS(=O)(=O)CCCOc1cccc2c(-c3ccnc(NC4CCC(NS(C)(=O)=O)CC4)n3)noc12 |
| InChI | InChI=1S/C22H29N5O6S2/c1-34(28,29)14-4-13-32-19-6-3-5-17-20(26-33-21(17)19)18-11-12-23-22(25-18)24-15-7-9-16(10-8-15)27-35(2,30)31/h3,5-6,11-12,15-16,27H,4,7-10,13-14H2,1-2H3,(H,23,24,25) |
| InChIKey | YAGFREQNWABDCA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 153.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.64 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|