About ethyl 3-(5-chloro-1H-pyrrolo[3,2-b]pyridin-2-yl)-2,2-dimethylpropanoate
ethyl 3-(5-chloro-1H-pyrrolo[3,2-b]pyridin-2-yl)-2,2-dimethylpropanoate (PubChem CID 59754792) has the molecular formula C14H17ClN2O2
and a molecular weight of 280.76 g/mol. Its IUPAC name is ethyl 3-(5-chloro-1H-pyrrolo[3,2-b]pyridin-2-yl)-2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | ethyl 3-(5-chloro-1H-pyrrolo[3,2-b]pyridin-2-yl)-2,2-dimethylpropanoate |
| PubChem CID | 59754792 |
| Molecular Formula | C14H17ClN2O2 |
| Molecular Weight | 280.76 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | ethyl 3-(5-chloro-1H-pyrrolo[3,2-b]pyridin-2-yl)-2,2-dimethylpropanoate |
| SMILES | CCOC(=O)C(C)(C)Cc1cc2nc(Cl)ccc2[nH]1 |
| InChI | InChI=1S/C14H17ClN2O2/c1-4-19-13(18)14(2,3)8-9-7-11-10(16-9)5-6-12(15)17-11/h5-7,16H,4,8H2,1-3H3 |
| InChIKey | XKVXGINFAOYDKT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.76 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-(5-chloro-1H-pyrrolo[3,2-b]pyridin-2-yl)-2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(5-chloro-1H-pyrrolo[3,2-b]pyridin-2-yl)-2,2-dimethylpropanoate?
The IUPAC name of ethyl 3-(5-chloro-1H-pyrrolo[3,2-b]pyridin-2-yl)-2,2-dimethylpropanoate (CID 59754792) is ethyl 3-(5-chloro-1H-pyrrolo[3,2-b]pyridin-2-yl)-2,2-dimethylpropanoate.
What is the SMILES notation for ethyl 3-(5-chloro-1H-pyrrolo[3,2-b]pyridin-2-yl)-2,2-dimethylpropanoate?
The canonical SMILES for ethyl 3-(5-chloro-1H-pyrrolo[3,2-b]pyridin-2-yl)-2,2-dimethylpropanoate is CCOC(=O)C(C)(C)Cc1cc2nc(Cl)ccc2[nH]1.
What is the InChIKey of ethyl 3-(5-chloro-1H-pyrrolo[3,2-b]pyridin-2-yl)-2,2-dimethylpropanoate?
The InChIKey is XKVXGINFAOYDKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17ClN2O2/c1-4-19-13(18)14(2,3)8-9-7-11-10(16-9)5-6-12(15)17-11/h5-7,16H,4,8H2,1-3H3.
What are the key properties of ethyl 3-(5-chloro-1H-pyrrolo[3,2-b]pyridin-2-yl)-2,2-dimethylpropanoate?
ethyl 3-(5-chloro-1H-pyrrolo[3,2-b]pyridin-2-yl)-2,2-dimethylpropanoate has a molecular weight of 280.76 g/mol, XLogP of 3.35, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(5-chloro-1H-pyrrolo[3,2-b]pyridin-2-yl)-2,2-dimethylpropanoate is sourced from PubChem (CID 59754792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).