C18H38N2 — CID 59773896
(E)-N,N,N',N'-tetratert-butylethene-1,2-diamine (PubChem CID 59773896) has the molecular formula C18H38N2 and a molecular weight of 282.52 g/mol. Its IUPAC name is (E)-N,N,N',N'-tetratert-butylethene-1,2-diamine.
| Compound Name | (E)-N,N,N',N'-tetratert-butylethene-1,2-diamine |
|---|---|
| PubChem CID | 59773896 |
| Molecular Formula | C18H38N2 |
| Molecular Weight | 282.52 g/mol |
| Exact Mass | 282.30 |
| IUPAC Name | (E)-N,N,N',N'-tetratert-butylethene-1,2-diamine |
| SMILES | CC(C)(C)N(/C=C/N(C(C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H38N2/c1-15(2,3)19(16(4,5)6)13-14-20(17(7,8)9)18(10,11)12/h13-14H,1-12H3/b14-13+ |
| InChIKey | XBEXLVORZBWGGN-BUHFOSPRSA-N |
| XLogP | 5.26 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.52 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |