C12H26N2 — CID 72569552
N,N'-ditert-butyl-N,N'-dimethylethene-1,2-diamine (PubChem CID 72569552) has the molecular formula C12H26N2 and a molecular weight of 198.35 g/mol. Its IUPAC name is N,N'-ditert-butyl-N,N'-dimethylethene-1,2-diamine.
| Compound Name | N,N'-ditert-butyl-N,N'-dimethylethene-1,2-diamine |
|---|---|
| PubChem CID | 72569552 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | N,N'-ditert-butyl-N,N'-dimethylethene-1,2-diamine |
| SMILES | CN(C=CN(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H26N2/c1-11(2,3)13(7)9-10-14(8)12(4,5)6/h9-10H,1-8H3 |
| InChIKey | KDAJMXFZJFRJDF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |