C14H18O5S — CID 59779797
(1,1-dioxo-3,4-dihydro-2,1λ6-benzoxathiin-7-yl)methyl 2-methylbutanoate (PubChem CID 59779797) has the molecular formula C14H18O5S and a molecular weight of 298.36 g/mol. Its IUPAC name is (1,1-dioxo-3,4-dihydro-2,1λ6-benzoxathiin-7-yl)methyl 2-methylbutanoate.
| Compound Name | (1,1-dioxo-3,4-dihydro-2,1λ6-benzoxathiin-7-yl)methyl 2-methylbutanoate |
|---|---|
| PubChem CID | 59779797 |
| Molecular Formula | C14H18O5S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | (1,1-dioxo-3,4-dihydro-2,1λ6-benzoxathiin-7-yl)methyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCc1ccc2c(c1)S(=O)(=O)OCC2 |
| InChI | InChI=1S/C14H18O5S/c1-3-10(2)14(15)18-9-11-4-5-12-6-7-19-20(16,17)13(12)8-11/h4-5,8,10H,3,6-7,9H2,1-2H3 |
| InChIKey | TZESQVQLXZEDOD-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|