About [2-(2,3-dihydro-1H-inden-5-yl)-7-methoxyquinolin-4-yl]methanol
[2-(2,3-dihydro-1H-inden-5-yl)-7-methoxyquinolin-4-yl]methanol (PubChem CID 59783217) has the molecular formula C20H19NO2
and a molecular weight of 305.38 g/mol. Its IUPAC name is [2-(2,3-dihydro-1H-inden-5-yl)-7-methoxyquinolin-4-yl]methanol.
Molecular Properties
| Compound Name | [2-(2,3-dihydro-1H-inden-5-yl)-7-methoxyquinolin-4-yl]methanol |
| PubChem CID | 59783217 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | [2-(2,3-dihydro-1H-inden-5-yl)-7-methoxyquinolin-4-yl]methanol |
| SMILES | COc1ccc2c(CO)cc(-c3ccc4c(c3)CCC4)nc2c1 |
| InChI | InChI=1S/C20H19NO2/c1-23-17-7-8-18-16(12-22)10-19(21-20(18)11-17)15-6-5-13-3-2-4-14(13)9-15/h5-11,22H,2-4,12H2,1H3 |
| InChIKey | WVRFTPIKUJEWPJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(2,3-dihydro-1H-inden-5-yl)-7-methoxyquinolin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,3-dihydro-1H-inden-5-yl)-7-methoxyquinolin-4-yl]methanol?
The IUPAC name of [2-(2,3-dihydro-1H-inden-5-yl)-7-methoxyquinolin-4-yl]methanol (CID 59783217) is [2-(2,3-dihydro-1H-inden-5-yl)-7-methoxyquinolin-4-yl]methanol.
What is the SMILES notation for [2-(2,3-dihydro-1H-inden-5-yl)-7-methoxyquinolin-4-yl]methanol?
The canonical SMILES for [2-(2,3-dihydro-1H-inden-5-yl)-7-methoxyquinolin-4-yl]methanol is COc1ccc2c(CO)cc(-c3ccc4c(c3)CCC4)nc2c1.
What is the InChIKey of [2-(2,3-dihydro-1H-inden-5-yl)-7-methoxyquinolin-4-yl]methanol?
The InChIKey is WVRFTPIKUJEWPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19NO2/c1-23-17-7-8-18-16(12-22)10-19(21-20(18)11-17)15-6-5-13-3-2-4-14(13)9-15/h5-11,22H,2-4,12H2,1H3.
What are the key properties of [2-(2,3-dihydro-1H-inden-5-yl)-7-methoxyquinolin-4-yl]methanol?
[2-(2,3-dihydro-1H-inden-5-yl)-7-methoxyquinolin-4-yl]methanol has a molecular weight of 305.38 g/mol, XLogP of 3.89, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,3-dihydro-1H-inden-5-yl)-7-methoxyquinolin-4-yl]methanol is sourced from PubChem (CID 59783217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).