C23H23ClN2O2S3 — CID 59786842
4-(4-chlorophenyl)sulfanyl-N-[(4-pentoxyphenyl)carbamothioyl]thiophene-3-carboxamide (PubChem CID 59786842) has the molecular formula C23H23ClN2O2S3 and a molecular weight of 491.10 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-N-[(4-pentoxyphenyl)carbamothioyl]thiophene-3-carboxamide.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-N-[(4-pentoxyphenyl)carbamothioyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 59786842 |
| Molecular Formula | C23H23ClN2O2S3 |
| Molecular Weight | 491.10 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-N-[(4-pentoxyphenyl)carbamothioyl]thiophene-3-carboxamide |
| SMILES | CCCCCOc1ccc(NC(=S)NC(=O)c2cscc2Sc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H23ClN2O2S3/c1-2-3-4-13-28-18-9-7-17(8-10-18)25-23(29)26-22(27)20-14-30-15-21(20)31-19-11-5-16(24)6-12-19/h5-12,14-15H,2-4,13H2,1H3,(H2,25,26,27,29) |
| InChIKey | PHNWZXQIOWLOON-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.10 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|