About (4S)-4-methyloct-7-ene-2,6-dione;yttrium
(4S)-4-methyloct-7-ene-2,6-dione;yttrium (PubChem CID 59788978) has the molecular formula C9H13O2Y-
and a molecular weight of 242.11 g/mol. Its IUPAC name is (4S)-4-methyloct-7-ene-2,6-dione;yttrium.
Molecular Properties
| Compound Name | (4S)-4-methyloct-7-ene-2,6-dione;yttrium |
| PubChem CID | 59788978 |
| Molecular Formula | C9H13O2Y- |
| Molecular Weight | 242.11 g/mol |
| Exact Mass | 242.00 |
| IUPAC Name | (4S)-4-methyloct-7-ene-2,6-dione;yttrium |
| SMILES | [H]/[C-]=C\C(=O)C[C@@H](C)CC(C)=O.[Y] |
| InChI | InChI=1S/C9H13O2.Y/c1-4-9(11)6-7(2)5-8(3)10;/h1,4,7H,5-6H2,2-3H3;/q-1;/t7-;/m0./s1 |
| InChIKey | UUZIIVKPQFGVRD-FJXQXJEOSA-N |
| XLogP | 1.55 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.11 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-methyloct-7-ene-2,6-dione;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-methyloct-7-ene-2,6-dione;yttrium?
The IUPAC name of (4S)-4-methyloct-7-ene-2,6-dione;yttrium (CID 59788978) is (4S)-4-methyloct-7-ene-2,6-dione;yttrium.
What is the SMILES notation for (4S)-4-methyloct-7-ene-2,6-dione;yttrium?
The canonical SMILES for (4S)-4-methyloct-7-ene-2,6-dione;yttrium is [H]/[C-]=C\C(=O)C[C@@H](C)CC(C)=O.[Y].
What is the InChIKey of (4S)-4-methyloct-7-ene-2,6-dione;yttrium?
The InChIKey is UUZIIVKPQFGVRD-FJXQXJEOSA-N. The full InChI is InChI=1S/C9H13O2.Y/c1-4-9(11)6-7(2)5-8(3)10;/h1,4,7H,5-6H2,2-3H3;/q-1;/t7-;/m0./s1.
What are the key properties of (4S)-4-methyloct-7-ene-2,6-dione;yttrium?
(4S)-4-methyloct-7-ene-2,6-dione;yttrium has a molecular weight of 242.11 g/mol, XLogP of 1.55, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-methyloct-7-ene-2,6-dione;yttrium is sourced from PubChem (CID 59788978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).