C34H33N3S — CID 59793450
4-methyl-N-phenyl-N-[4-(7,11,14,14-tetramethyl-6-thia-3,9-diazatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4,7,9-tetraen-5-yl)phenyl]aniline (PubChem CID 59793450) has the molecular formula C34H33N3S and a molecular weight of 515.73 g/mol. Its IUPAC name is 4-methyl-N-phenyl-N-[4-(7,11,14,14-tetramethyl-6-thia-3,9-diazatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4,7,9-tetraen-5-yl)phenyl]aniline.
| Compound Name | 4-methyl-N-phenyl-N-[4-(7,11,14,14-tetramethyl-6-thia-3,9-diazatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4,7,9-tetraen-5-yl)phenyl]aniline |
|---|---|
| PubChem CID | 59793450 |
| Molecular Formula | C34H33N3S |
| Molecular Weight | 515.73 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | 4-methyl-N-phenyl-N-[4-(7,11,14,14-tetramethyl-6-thia-3,9-diazatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4,7,9-tetraen-5-yl)phenyl]aniline |
| SMILES | Cc1ccc(N(c2ccccc2)c2ccc(-c3sc(C)c4nc5c(nc34)C3CCC5(C)C3(C)C)cc2)cc1 |
| InChI | InChI=1S/C34H33N3S/c1-21-11-15-25(16-12-21)37(24-9-7-6-8-10-24)26-17-13-23(14-18-26)31-30-28(22(2)38-31)36-32-29(35-30)27-19-20-34(32,5)33(27,3)4/h6-18,27H,19-20H2,1-5H3 |
| InChIKey | HMQVHQKVGMMHSS-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.73 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |