C48H36IrN2OP- — CID 59800383
(2-hydroxyphenyl)-diphenylphosphanium;iridium;bis(1-phenylisoquinoline) (PubChem CID 59800383) has the molecular formula C48H36IrN2OP- and a molecular weight of 880.02 g/mol. Its IUPAC name is (2-hydroxyphenyl)-diphenylphosphanium;iridium;bis(1-phenylisoquinoline).
| Compound Name | (2-hydroxyphenyl)-diphenylphosphanium;iridium;bis(1-phenylisoquinoline) |
|---|---|
| PubChem CID | 59800383 |
| Molecular Formula | C48H36IrN2OP- |
| Molecular Weight | 880.02 g/mol |
| Exact Mass | 880.22 |
| IUPAC Name | (2-hydroxyphenyl)-diphenylphosphanium;iridium;bis(1-phenylisoquinoline) |
| SMILES | Oc1ccccc1[PH+](c1ccccc1)c1ccccc1.[Ir].[c-]1ccccc1-c1nccc2ccccc12.[c-]1ccccc1-c1nccc2ccccc12 |
| InChI | InChI=1S/C18H15OP.2C15H10N.Ir/c19-17-13-7-8-14-18(17)20(15-9-3-1-4-10-15)16-11-5-2-6-12-16;2*1-2-7-13(8-3-1)15-14-9-5-4-6-12(14)10-11-16-15;/h1-14,19H;2*1-7,9-11H;/q;2*-1;/p+1 |
| InChIKey | IKJNZHABOGMLRJ-UHFFFAOYSA-O |
| XLogP | 10.28 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.02 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|