C23H23N3O5S — CID 59803093
4-oxo-1'-phenylmethoxycarbonylspiro[3,5,6,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7,4'-piperidine]-2-carboxylic acid (PubChem CID 59803093) has the molecular formula C23H23N3O5S and a molecular weight of 453.52 g/mol. Its IUPAC name is 4-oxo-1'-phenylmethoxycarbonylspiro[3,5,6,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7,4'-piperidine]-2-carboxylic acid.
| Compound Name | 4-oxo-1'-phenylmethoxycarbonylspiro[3,5,6,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7,4'-piperidine]-2-carboxylic acid |
|---|---|
| PubChem CID | 59803093 |
| Molecular Formula | C23H23N3O5S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | 4-oxo-1'-phenylmethoxycarbonylspiro[3,5,6,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7,4'-piperidine]-2-carboxylic acid |
| SMILES | O=C(O)c1nc2sc3c(c2c(=O)[nH]1)CCC1(CCN(C(=O)OCc2ccccc2)CC1)C3 |
| InChI | InChI=1S/C23H23N3O5S/c27-19-17-15-6-7-23(12-16(15)32-20(17)25-18(24-19)21(28)29)8-10-26(11-9-23)22(30)31-13-14-4-2-1-3-5-14/h1-5H,6-13H2,(H,28,29)(H,24,25,27) |
| InChIKey | NZXKFAMBVYHFAZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 112.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |