C14H25NO7Si — CID 59804570
CID 59804570 (PubChem CID 59804570) has the molecular formula C14H25NO7Si and a molecular weight of 347.44 g/mol.
| Compound Name | CID 59804570 |
|---|---|
| PubChem CID | 59804570 |
| Molecular Formula | C14H25NO7Si |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | — |
| SMILES | CO[Si]CCCNC(=O)OC(COCC1CO1)COCC1CO1 |
| InChI | InChI=1S/C14H25NO7Si/c1-17-23-4-2-3-15-14(16)22-13(7-18-5-11-9-20-11)8-19-6-12-10-21-12/h11-13H,2-10H2,1H3,(H,15,16) |
| InChIKey | HLINVQOUBJWITK-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 91.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|