C19H37NO9Si — CID 87670478
[1-methoxy-1-(oxiran-2-yl)-3-(oxiran-2-ylmethoxy)propan-2-yl] N-(3-triethoxysilylpropyl)carbamate (PubChem CID 87670478) has the molecular formula C19H37NO9Si and a molecular weight of 451.59 g/mol. Its IUPAC name is [1-methoxy-1-(oxiran-2-yl)-3-(oxiran-2-ylmethoxy)propan-2-yl] N-(3-triethoxysilylpropyl)carbamate.
| Compound Name | [1-methoxy-1-(oxiran-2-yl)-3-(oxiran-2-ylmethoxy)propan-2-yl] N-(3-triethoxysilylpropyl)carbamate |
|---|---|
| PubChem CID | 87670478 |
| Molecular Formula | C19H37NO9Si |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | [1-methoxy-1-(oxiran-2-yl)-3-(oxiran-2-ylmethoxy)propan-2-yl] N-(3-triethoxysilylpropyl)carbamate |
| SMILES | CCO[Si](CCCNC(=O)OC(COCC1CO1)C(OC)C1CO1)(OCC)OCC |
| InChI | InChI=1S/C19H37NO9Si/c1-5-26-30(27-6-2,28-7-3)10-8-9-20-19(21)29-17(13-23-11-15-12-24-15)18(22-4)16-14-25-16/h15-18H,5-14H2,1-4H3,(H,20,21) |
| InChIKey | VZAMRPXVXGVATJ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|