C25H34O6 — CID 59806042
(1R,7S,9E,11S,17R)-7-[(1S)-1-hydroxyprop-2-enyl]-11-(methoxymethoxy)-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-9,19-dien-3-yn-5-one (PubChem CID 59806042) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is (1R,7S,9E,11S,17R)-7-[(1S)-1-hydroxyprop-2-enyl]-11-(methoxymethoxy)-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-9,19-dien-3-yn-5-one.
| Compound Name | (1R,7S,9E,11S,17R)-7-[(1S)-1-hydroxyprop-2-enyl]-11-(methoxymethoxy)-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-9,19-dien-3-yn-5-one |
|---|---|
| PubChem CID | 59806042 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | (1R,7S,9E,11S,17R)-7-[(1S)-1-hydroxyprop-2-enyl]-11-(methoxymethoxy)-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-9,19-dien-3-yn-5-one |
| SMILES | C=C[C@H](O)[C@@H]1C/C=C/[C@@H](OCOC)CC(=C)CCC[C@@H]2CC=C[C@@H](CC#CC(=O)O1)O2 |
| InChI | InChI=1S/C25H34O6/c1-4-23(26)24-15-7-14-22(29-18-28-3)17-19(2)9-5-10-20-11-6-12-21(30-20)13-8-16-25(27)31-24/h4,6-7,12,14,20-24,26H,1-2,5,9-11,13,15,17-18H2,3H3/b14-7+/t20-,21+,22-,23+,24+/m1/s1 |
| InChIKey | CXNXNWQEPRLOGN-UIRAVDJVSA-N |
| XLogP | 3.62 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|