C18H19FO5S — CID 59820441
methyl 2-[3-(4-fluorophenyl)sulfonyl-5-propoxyphenyl]acetate (PubChem CID 59820441) has the molecular formula C18H19FO5S and a molecular weight of 366.41 g/mol. Its IUPAC name is methyl 2-[3-(4-fluorophenyl)sulfonyl-5-propoxyphenyl]acetate.
| Compound Name | methyl 2-[3-(4-fluorophenyl)sulfonyl-5-propoxyphenyl]acetate |
|---|---|
| PubChem CID | 59820441 |
| Molecular Formula | C18H19FO5S |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | methyl 2-[3-(4-fluorophenyl)sulfonyl-5-propoxyphenyl]acetate |
| SMILES | CCCOc1cc(CC(=O)OC)cc(S(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C18H19FO5S/c1-3-8-24-15-9-13(11-18(20)23-2)10-17(12-15)25(21,22)16-6-4-14(19)5-7-16/h4-7,9-10,12H,3,8,11H2,1-2H3 |
| InChIKey | HZBNEVNWMATMCN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |