About CID 59824295
CID 59824295 (PubChem CID 59824295) has the molecular formula C8H25O3Si4
and a molecular weight of 281.63 g/mol.
Molecular Properties
| Compound Name | CID 59824295 |
| PubChem CID | 59824295 |
| Molecular Formula | C8H25O3Si4 |
| Molecular Weight | 281.63 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | — |
| SMILES | C[Si](O[SiH](C)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C8H25O3Si4/c1-12(10-14(3,4)5)9-13(2)11-15(6,7)8/h12H,1-8H3 |
| InChIKey | QOHRYYXZKBDJSS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.63 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 59824295 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59824295?
The IUPAC name of CID 59824295 (CID 59824295) is not available.
What is the SMILES notation for CID 59824295?
The canonical SMILES for CID 59824295 is C[Si](O[SiH](C)O[Si](C)(C)C)O[Si](C)(C)C.
What is the InChIKey of CID 59824295?
The InChIKey is QOHRYYXZKBDJSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H25O3Si4/c1-12(10-14(3,4)5)9-13(2)11-15(6,7)8/h12H,1-8H3.
What are the key properties of CID 59824295?
CID 59824295 has a molecular weight of 281.63 g/mol, XLogP of 2.67, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59824295 is sourced from PubChem (CID 59824295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).