C27H52 — CID 59827532
(3aS)-2-tert-butyl-6-(4,4-dimethylpentan-2-yl)-1,3,4,5,6,7,7-heptamethyl-2,3,3a,4,5,7a-hexahydro-1H-indene (PubChem CID 59827532) has the molecular formula C27H52 and a molecular weight of 376.71 g/mol. Its IUPAC name is (3aS)-2-tert-butyl-6-(4,4-dimethylpentan-2-yl)-1,3,4,5,6,7,7-heptamethyl-2,3,3a,4,5,7a-hexahydro-1H-indene.
| Compound Name | (3aS)-2-tert-butyl-6-(4,4-dimethylpentan-2-yl)-1,3,4,5,6,7,7-heptamethyl-2,3,3a,4,5,7a-hexahydro-1H-indene |
|---|---|
| PubChem CID | 59827532 |
| Molecular Formula | C27H52 |
| Molecular Weight | 376.71 g/mol |
| Exact Mass | 376.41 |
| IUPAC Name | (3aS)-2-tert-butyl-6-(4,4-dimethylpentan-2-yl)-1,3,4,5,6,7,7-heptamethyl-2,3,3a,4,5,7a-hexahydro-1H-indene |
| SMILES | CC1C(C(C)(C)C)C(C)[C@@H]2C(C)C(C)C(C)(C(C)CC(C)(C)C)C(C)(C)C12 |
| InChI | InChI=1S/C27H52/c1-16(15-24(6,7)8)27(14)20(5)17(2)21-18(3)22(25(9,10)11)19(4)23(21)26(27,12)13/h16-23H,15H2,1-14H3/t16?,17?,18?,19?,20?,21-,22?,23?,27?/m0/s1 |
| InChIKey | XHONZLVGNLOCJO-FKMJOFDXSA-N |
| XLogP | 8.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.71 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |